ChemNet > CAS > 98800-10-3 methyl thieno[3,2-b]thiophene-2-carboxylate
98800-10-3 methyl thieno[3,2-b]thiophene-2-carboxylate
Nama produk |
methyl thieno[3,2-b]thiophene-2-carboxylate |
MF |
C8H6O2S2 |
Berat Molekul |
198.262 |
InChI |
InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
CAS NO |
98800-10-3 |
Struktur Molekul |
|
Kepadatan |
1.412g/cm3 |
Titik lebur |
94℃ |
Titik didih |
306.1°C at 760 mmHg |
Indeks bias |
1.673 |
Titik nyala |
138.9°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|